C24H22F3N5O — CID 91303299
N,N-dimethyl-1-[6-[1-[C-methyl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]indol-5-yl]oxypyrimidin-4-yl]methanamine (PubChem CID 91303299) has the molecular formula C24H22F3N5O and a molecular weight of 453.47 g/mol. Its IUPAC name is N,N-dimethyl-1-[6-[1-[C-methyl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]indol-5-yl]oxypyrimidin-4-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[6-[1-[C-methyl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]indol-5-yl]oxypyrimidin-4-yl]methanamine |
|---|---|
| PubChem CID | 91303299 |
| Molecular Formula | C24H22F3N5O |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N,N-dimethyl-1-[6-[1-[C-methyl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]indol-5-yl]oxypyrimidin-4-yl]methanamine |
| SMILES | C/C(=N\c1cccc(C(F)(F)F)c1)n1ccc2cc(Oc3cc(CN(C)C)ncn3)ccc21 |
| InChI | InChI=1S/C24H22F3N5O/c1-16(30-19-6-4-5-18(12-19)24(25,26)27)32-10-9-17-11-21(7-8-22(17)32)33-23-13-20(14-31(2)3)28-15-29-23/h4-13,15H,14H2,1-3H3/b30-16+ |
| InChIKey | QSRMFHYVKALTIE-OKCVXOCRSA-N |
| XLogP | 5.90 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|