C6H9NO2 — CID 91304045
spiro[7-oxa-2-azabicyclo[4.1.0]heptane-3,2'-oxirane] (PubChem CID 91304045) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is spiro[7-oxa-2-azabicyclo[4.1.0]heptane-3,2'-oxirane].
| Compound Name | spiro[7-oxa-2-azabicyclo[4.1.0]heptane-3,2'-oxirane] |
|---|---|
| PubChem CID | 91304045 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | spiro[7-oxa-2-azabicyclo[4.1.0]heptane-3,2'-oxirane] |
| SMILES | C1CC2(CO2)NC2OC12 |
| InChI | InChI=1S/C6H9NO2/c1-2-6(3-8-6)7-5-4(1)9-5/h4-5,7H,1-3H2 |
| InChIKey | AYTUFJDVODYBSY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 37.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|