C23H28N2O4S2 — CID 91304085
N-[1-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]pyrrolidin-2-yl]-2-sulfanylbenzenesulfonamide (PubChem CID 91304085) has the molecular formula C23H28N2O4S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[1-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]pyrrolidin-2-yl]-2-sulfanylbenzenesulfonamide.
| Compound Name | N-[1-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]pyrrolidin-2-yl]-2-sulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 91304085 |
| Molecular Formula | C23H28N2O4S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | N-[1-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]pyrrolidin-2-yl]-2-sulfanylbenzenesulfonamide |
| SMILES | O=C(c1ccc(OCCCN2CCCC2NS(=O)(=O)c2ccccc2S)cc1)C1CC1 |
| InChI | InChI=1S/C23H28N2O4S2/c26-23(17-8-9-17)18-10-12-19(13-11-18)29-16-4-15-25-14-3-7-22(25)24-31(27,28)21-6-2-1-5-20(21)30/h1-2,5-6,10-13,17,22,24,30H,3-4,7-9,14-16H2 |
| InChIKey | IUCUSWJFEBKQPN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|