C38H42O6 — CID 91305856
(1R,3S,4S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-methylphenyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol;but-1-ene (PubChem CID 91305856) has the molecular formula C38H42O6 and a molecular weight of 594.75 g/mol. Its IUPAC name is (1R,3S,4S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-methylphenyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol;but-1-ene.
| Compound Name | (1R,3S,4S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-methylphenyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol;but-1-ene |
|---|---|
| PubChem CID | 91305856 |
| Molecular Formula | C38H42O6 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | (1R,3S,4S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-methylphenyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol;but-1-ene |
| SMILES | C=CCC.COc1ccc(C(OC[C@]23CO[C@@H](C2O)[C@H](c2ccccc2C)O3)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H34O6.C4H8/c1-23-9-7-8-12-29(23)30-31-32(35)33(40-30,21-38-31)22-39-34(24-10-5-4-6-11-24,25-13-17-27(36-2)18-14-25)26-15-19-28(37-3)20-16-26;1-3-4-2/h4-20,30-32,35H,21-22H2,1-3H3;3H,1,4H2,2H3/t30-,31+,32?,33+;/m0./s1 |
| InChIKey | KFNLEVCPIDPBPT-BZFDMANPSA-N |
| XLogP | 7.17 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|