C28H30ClN3O5S — CID 91306764
6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione (PubChem CID 91306764) has the molecular formula C28H30ClN3O5S and a molecular weight of 556.08 g/mol. Its IUPAC name is 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91306764 |
| Molecular Formula | C28H30ClN3O5S |
| Molecular Weight | 556.08 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Sc3n[nH]c(-c4ccccc4)n3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C28H30ClN3O5S/c1-35-22-15-23(36-2)20(29)14-18(22)12-13-28(19-10-6-7-11-19)16-21(33)24(26(34)37-28)38-27-30-25(31-32-27)17-8-4-3-5-9-17/h3-5,8-9,14-15,19,24H,6-7,10-13,16H2,1-2H3,(H,30,31,32) |
| InChIKey | ZNBUNTIGHXQYPJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.08 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|