C18H17ClN2O3 — CID 91306832
1-[2-chloro-1-hydroxy-2-(1-quinolin-6-ylcyclopropyl)ethyl]pyrrole-2,5-diol (PubChem CID 91306832) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is 1-[2-chloro-1-hydroxy-2-(1-quinolin-6-ylcyclopropyl)ethyl]pyrrole-2,5-diol.
| Compound Name | 1-[2-chloro-1-hydroxy-2-(1-quinolin-6-ylcyclopropyl)ethyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91306832 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-[2-chloro-1-hydroxy-2-(1-quinolin-6-ylcyclopropyl)ethyl]pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1C(O)C(Cl)C1(c2ccc3ncccc3c2)CC1 |
| InChI | InChI=1S/C18H17ClN2O3/c19-16(17(24)21-14(22)5-6-15(21)23)18(7-8-18)12-3-4-13-11(10-12)2-1-9-20-13/h1-6,9-10,16-17,22-24H,7-8H2 |
| InChIKey | AWDAWJURYIEFCE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|