C18H13F5N6S — CID 91307988
2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]-2-[2-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]acetonitrile (PubChem CID 91307988) has the molecular formula C18H13F5N6S and a molecular weight of 440.40 g/mol. Its IUPAC name is 2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]-2-[2-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]acetonitrile.
| Compound Name | 2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]-2-[2-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 91307988 |
| Molecular Formula | C18H13F5N6S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]-2-[2-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]acetonitrile |
| SMILES | N#CC(c1ccnc(NCCc2cccnc2)n1)c1nc(C(F)(F)C(F)(F)F)cs1 |
| InChI | InChI=1S/C18H13F5N6S/c19-17(20,18(21,22)23)14-10-30-15(29-14)12(8-24)13-4-7-27-16(28-13)26-6-3-11-2-1-5-25-9-11/h1-2,4-5,7,9-10,12H,3,6H2,(H,26,27,28) |
| InChIKey | ACSGIZCOJKIITN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|