C25H30N6O3 — CID 91311117
tert-butyl N-methyl-N-[1-[4-[(3-pyridin-3-yl-1H-pyrazole-5-carbonyl)amino]phenyl]pyrrolidin-3-yl]carbamate (PubChem CID 91311117) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-[4-[(3-pyridin-3-yl-1H-pyrazole-5-carbonyl)amino]phenyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-[4-[(3-pyridin-3-yl-1H-pyrazole-5-carbonyl)amino]phenyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 91311117 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | tert-butyl N-methyl-N-[1-[4-[(3-pyridin-3-yl-1H-pyrazole-5-carbonyl)amino]phenyl]pyrrolidin-3-yl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCN(c2ccc(NC(=O)c3cc(-c4cccnc4)n[nH]3)cc2)C1 |
| InChI | InChI=1S/C25H30N6O3/c1-25(2,3)34-24(33)30(4)20-11-13-31(16-20)19-9-7-18(8-10-19)27-23(32)22-14-21(28-29-22)17-6-5-12-26-15-17/h5-10,12,14-15,20H,11,13,16H2,1-4H3,(H,27,32)(H,28,29) |
| InChIKey | MCIUACCUWVQMLX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|