About 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane
4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane (PubChem CID 91312215) has the molecular formula C17H27N
and a molecular weight of 245.41 g/mol. Its IUPAC name is 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane.
Molecular Properties
| Compound Name | 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane |
| PubChem CID | 91312215 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane |
| SMILES | CC.CC1=c2ccccc2=C(C(C)(C)C)CN1C |
| InChI | InChI=1S/C15H21N.C2H6/c1-11-12-8-6-7-9-13(12)14(10-16(11)5)15(2,3)4;1-2/h6-9H,10H2,1-5H3;1-2H3 |
| InChIKey | QFMYOCWCQKJJGT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane?
The IUPAC name of 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane (CID 91312215) is 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane.
What is the SMILES notation for 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane?
The canonical SMILES for 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane is CC.CC1=c2ccccc2=C(C(C)(C)C)CN1C.
What is the InChIKey of 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane?
The InChIKey is QFMYOCWCQKJJGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N.C2H6/c1-11-12-8-6-7-9-13(12)14(10-16(11)5)15(2,3)4;1-2/h6-9H,10H2,1-5H3;1-2H3.
What are the key properties of 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane?
4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane has a molecular weight of 245.41 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,2-dimethyl-3H-isoquinoline;ethane is sourced from PubChem (CID 91312215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).