C10H8ClNO3 — CID 91313181
N-(1,4-benzodioxin-5-yl)-2-chloroacetamide (PubChem CID 91313181) has the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. Its IUPAC name is N-(1,4-benzodioxin-5-yl)-2-chloroacetamide.
| Compound Name | N-(1,4-benzodioxin-5-yl)-2-chloroacetamide |
|---|---|
| PubChem CID | 91313181 |
| Molecular Formula | C10H8ClNO3 |
| Molecular Weight | 225.63 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | N-(1,4-benzodioxin-5-yl)-2-chloroacetamide |
| SMILES | O=C(CCl)Nc1cccc2c1OC=CO2 |
| InChI | InChI=1S/C10H8ClNO3/c11-6-9(13)12-7-2-1-3-8-10(7)15-5-4-14-8/h1-5H,6H2,(H,12,13) |
| InChIKey | OSNYNMRMAYYIIL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|