C10H11ClN2O2 — CID 167119083
2-chloro-N-(3,4-dihydro-2H-1,4-benzoxazin-8-yl)acetamide (PubChem CID 167119083) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dihydro-2H-1,4-benzoxazin-8-yl)acetamide.
| Compound Name | 2-chloro-N-(3,4-dihydro-2H-1,4-benzoxazin-8-yl)acetamide |
|---|---|
| PubChem CID | 167119083 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-chloro-N-(3,4-dihydro-2H-1,4-benzoxazin-8-yl)acetamide |
| SMILES | O=C(CCl)Nc1cccc2c1OCCN2 |
| InChI | InChI=1S/C10H11ClN2O2/c11-6-9(14)13-8-3-1-2-7-10(8)15-5-4-12-7/h1-3,12H,4-6H2,(H,13,14) |
| InChIKey | NZAFLCVWBPEPFA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|