C19H33N3O2 — CID 91313387
N-(2,5-dimethylpyrazol-3-yl)-3-oxotetradecanamide (PubChem CID 91313387) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is N-(2,5-dimethylpyrazol-3-yl)-3-oxotetradecanamide.
| Compound Name | N-(2,5-dimethylpyrazol-3-yl)-3-oxotetradecanamide |
|---|---|
| PubChem CID | 91313387 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | N-(2,5-dimethylpyrazol-3-yl)-3-oxotetradecanamide |
| SMILES | CCCCCCCCCCCC(=O)CC(=O)Nc1cc(C)nn1C |
| InChI | InChI=1S/C19H33N3O2/c1-4-5-6-7-8-9-10-11-12-13-17(23)15-19(24)20-18-14-16(2)21-22(18)3/h14H,4-13,15H2,1-3H3,(H,20,24) |
| InChIKey | ANNLXVKFFOWART-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|