C32H24N4O8 — CID 91313440
4-[5-[3-[4-[bis(carboxymethyl)amino]phenyl]propa-1,2-dienyl]-3,6-dioxo-4-phenyl-1,7-dihydropyrazolo[3,4-b]pyridin-2-yl]benzoic acid (PubChem CID 91313440) has the molecular formula C32H24N4O8 and a molecular weight of 592.56 g/mol. Its IUPAC name is 4-[5-[3-[4-[bis(carboxymethyl)amino]phenyl]propa-1,2-dienyl]-3,6-dioxo-4-phenyl-1,7-dihydropyrazolo[3,4-b]pyridin-2-yl]benzoic acid.
| Compound Name | 4-[5-[3-[4-[bis(carboxymethyl)amino]phenyl]propa-1,2-dienyl]-3,6-dioxo-4-phenyl-1,7-dihydropyrazolo[3,4-b]pyridin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 91313440 |
| Molecular Formula | C32H24N4O8 |
| Molecular Weight | 592.56 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | 4-[5-[3-[4-[bis(carboxymethyl)amino]phenyl]propa-1,2-dienyl]-3,6-dioxo-4-phenyl-1,7-dihydropyrazolo[3,4-b]pyridin-2-yl]benzoic acid |
| SMILES | O=C(O)CN(CC(=O)O)c1ccc(C=C=Cc2c(-c3ccccc3)c3c(=O)n(-c4ccc(C(=O)O)cc4)[nH]c3[nH]c2=O)cc1 |
| InChI | InChI=1S/C32H24N4O8/c37-25(38)17-35(18-26(39)40)22-13-9-19(10-14-22)5-4-8-24-27(20-6-2-1-3-7-20)28-29(33-30(24)41)34-36(31(28)42)23-15-11-21(12-16-23)32(43)44/h1-3,5-16H,17-18H2,(H,37,38)(H,39,40)(H,43,44)(H2,33,34,41) |
| InChIKey | FEAKFPQRWFYNTG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 185.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|