C32H26N4O6 — CID 91284475
4-[2-(4-carboxyphenyl)-5-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-4-methyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoic acid (PubChem CID 91284475) has the molecular formula C32H26N4O6 and a molecular weight of 562.58 g/mol. Its IUPAC name is 4-[2-(4-carboxyphenyl)-5-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-4-methyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoic acid.
| Compound Name | 4-[2-(4-carboxyphenyl)-5-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-4-methyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoic acid |
|---|---|
| PubChem CID | 91284475 |
| Molecular Formula | C32H26N4O6 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | 4-[2-(4-carboxyphenyl)-5-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-4-methyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridin-7-yl]benzoic acid |
| SMILES | Cc1c(C=C=Cc2ccc(N(C)C)cc2)c(=O)n(-c2ccc(C(=O)O)cc2)c2[nH]n(-c3ccc(C(=O)O)cc3)c(=O)c12 |
| InChI | InChI=1S/C32H26N4O6/c1-19-26(6-4-5-20-7-13-23(14-8-20)34(2)3)29(37)35(24-15-9-21(10-16-24)31(39)40)28-27(19)30(38)36(33-28)25-17-11-22(12-18-25)32(41)42/h5-18,33H,1-3H3,(H,39,40)(H,41,42) |
| InChIKey | NZMICZGHIGIDQW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 137.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|