C17H21N3O2 — CID 54138448
4-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-2-(2-hydroxyethyl)-5-methyl-1H-pyrazol-3-one (PubChem CID 54138448) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-2-(2-hydroxyethyl)-5-methyl-1H-pyrazol-3-one.
| Compound Name | 4-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-2-(2-hydroxyethyl)-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 54138448 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 4-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-2-(2-hydroxyethyl)-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(CCO)c(=O)c1C=C=Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H21N3O2/c1-13-16(17(22)20(18-13)11-12-21)6-4-5-14-7-9-15(10-8-14)19(2)3/h5-10,18,21H,11-12H2,1-3H3 |
| InChIKey | NZJLFEXIHFNSST-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 61.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|