C25H25N3O5 — CID 91490959
3-[5-(aminomethoxy)-3-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-2-hydroxy-4-methyl-6-oxo-1-pyridinyl]benzoic acid (PubChem CID 91490959) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is 3-[5-(aminomethoxy)-3-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-2-hydroxy-4-methyl-6-oxo-1-pyridinyl]benzoic acid.
| Compound Name | 3-[5-(aminomethoxy)-3-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-2-hydroxy-4-methyl-6-oxo-1-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 91490959 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 3-[5-(aminomethoxy)-3-[3-[4-(dimethylamino)phenyl]propa-1,2-dienyl]-2-hydroxy-4-methyl-6-oxo-1-pyridinyl]benzoic acid |
| SMILES | Cc1c(C=C=Cc2ccc(N(C)C)cc2)c(O)n(-c2cccc(C(=O)O)c2)c(=O)c1OCN |
| InChI | InChI=1S/C25H25N3O5/c1-16-21(9-4-6-17-10-12-19(13-11-17)27(2)3)23(29)28(24(30)22(16)33-15-26)20-8-5-7-18(14-20)25(31)32/h5-14,29H,15,26H2,1-3H3,(H,31,32) |
| InChIKey | MUDOWWJCFDXKHK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|