C20H27N3O6 — CID 91319727
[8-[2-(2-methoxyethoxy)acetyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-benzylcarbamate (PubChem CID 91319727) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is [8-[2-(2-methoxyethoxy)acetyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-benzylcarbamate.
| Compound Name | [8-[2-(2-methoxyethoxy)acetyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 91319727 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | [8-[2-(2-methoxyethoxy)acetyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-benzylcarbamate |
| SMILES | COCCOCC(=O)N1CCC2(C=C(OC(=O)NCc3ccccc3)NO2)CC1 |
| InChI | InChI=1S/C20H27N3O6/c1-26-11-12-27-15-18(24)23-9-7-20(8-10-23)13-17(22-29-20)28-19(25)21-14-16-5-3-2-4-6-16/h2-6,13,22H,7-12,14-15H2,1H3,(H,21,25) |
| InChIKey | HJMQRMKGFRFAND-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|