C35H46BN3O8 — CID 91321026
tert-butyl (2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate;(2R)-2-(methoxycarbonylamino)-2-phenylacetic acid (PubChem CID 91321026) has the molecular formula C35H46BN3O8 and a molecular weight of 647.58 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate;(2R)-2-(methoxycarbonylamino)-2-phenylacetic acid.
| Compound Name | tert-butyl (2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate;(2R)-2-(methoxycarbonylamino)-2-phenylacetic acid |
|---|---|
| PubChem CID | 91321026 |
| Molecular Formula | C35H46BN3O8 |
| Molecular Weight | 647.58 g/mol |
| Exact Mass | 647.34 |
| IUPAC Name | tert-butyl (2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate;(2R)-2-(methoxycarbonylamino)-2-phenylacetic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1.COC(=O)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H35BN2O4.C10H11NO4/c1-23(2,3)30-22(29)28-14-8-9-21(28)20-15-18(16-27-20)17-10-12-19(13-11-17)26-31-24(4,5)25(6,7)32-26;1-15-10(14)11-8(9(12)13)7-5-3-2-4-6-7/h10-13,16,21H,8-9,14-15H2,1-7H3;2-6,8H,1H3,(H,11,14)(H,12,13)/t21-;8-/m01/s1 |
| InChIKey | KRTXQJAQZBWZCQ-YOKGILTMSA-N |
| XLogP | 5.74 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|