C30H34BN3O5 — CID 159277476
methyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate (PubChem CID 159277476) has the molecular formula C30H34BN3O5 and a molecular weight of 527.43 g/mol. Its IUPAC name is methyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate.
| Compound Name | methyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 159277476 |
| Molecular Formula | C30H34BN3O5 |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | methyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate |
| SMILES | COC(=O)N[C@@H](C(=O)N1CC=C[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C30H34BN3O5/c1-29(2)30(3,4)39-31(38-29)23-15-13-20(14-16-23)22-18-24(32-19-22)25-12-9-17-34(25)27(35)26(33-28(36)37-5)21-10-7-6-8-11-21/h6-16,19,25-26H,17-18H2,1-5H3,(H,33,36)/t25-,26+/m0/s1 |
| InChIKey | KYMOBPKGHVWUTP-IZZNHLLZSA-N |
| XLogP | 4.04 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|