C25H35BN4O4 — CID 58180654
3-[[4-(4-ethyl-1-methyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-one (PubChem CID 58180654) has the molecular formula C25H35BN4O4 and a molecular weight of 466.39 g/mol. Its IUPAC name is 3-[[4-(4-ethyl-1-methyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-one.
| Compound Name | 3-[[4-(4-ethyl-1-methyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-one |
|---|---|
| PubChem CID | 58180654 |
| Molecular Formula | C25H35BN4O4 |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 3-[[4-(4-ethyl-1-methyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-one |
| SMILES | CCN1CCN(C)C(c2ccc(Cc3nc(B4OC(C)(C)C(C)(C)O4)cn(C)c3=O)cc2)C1=O |
| InChI | InChI=1S/C25H35BN4O4/c1-8-30-14-13-28(6)21(23(30)32)18-11-9-17(10-12-18)15-19-22(31)29(7)16-20(27-19)26-33-24(2,3)25(4,5)34-26/h9-12,16,21H,8,13-15H2,1-7H3 |
| InChIKey | JRBCKLXSJAUHLM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|