C31H41BBrN5O4 — CID 123160463
5-bromo-3-[[4-(1,4-dimethyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methylpyrazin-2-one;2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 123160463) has the molecular formula C31H41BBrN5O4 and a molecular weight of 638.42 g/mol. Its IUPAC name is 5-bromo-3-[[4-(1,4-dimethyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methylpyrazin-2-one;2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 5-bromo-3-[[4-(1,4-dimethyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methylpyrazin-2-one;2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 123160463 |
| Molecular Formula | C31H41BBrN5O4 |
| Molecular Weight | 638.42 g/mol |
| Exact Mass | 637.24 |
| IUPAC Name | 5-bromo-3-[[4-(1,4-dimethyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methylpyrazin-2-one;2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CN1CCN(C)C(c2ccc(Cc3nc(Br)cn(C)c3=O)cc2)C1=O.Cc1c(N)cccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H21BrN4O2.C13H20BNO2/c1-21-8-9-22(2)18(25)16(21)13-6-4-12(5-7-13)10-14-17(24)23(3)11-15(19)20-14;1-9-10(7-6-8-11(9)15)14-16-12(2,3)13(4,5)17-14/h4-7,11,16H,8-10H2,1-3H3;6-8H,15H2,1-5H3 |
| InChIKey | LBJAHLSYKYCGJZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|