C20H20N4O3 — CID 137796682
US10150767, Example 26 (PubChem CID 137796682) has the molecular formula C20H20N4O3 and a molecular weight of 364.40 g/mol. Its IUPAC name is 6-methyl-4-[4-(4-methyl-3-oxopiperazine-1-carbonyl)phenyl]-3aH-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | US10150767, Example 26 |
|---|---|
| PubChem CID | 137796682 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 6-methyl-4-[4-(4-methyl-3-oxopiperazine-1-carbonyl)phenyl]-3aH-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | CN1CCN(CC1=O)C(=O)C2=CC=C(C=C2)C3=CN(C(=O)C4=NC=CC34)C |
| InChI | InChI=1S/C20H20N4O3/c1-22-9-10-24(12-17(22)25)19(26)14-5-3-13(4-6-14)16-11-23(2)20(27)18-15(16)7-8-21-18/h3-8,11,15H,9-10,12H2,1-2H3 |
| InChIKey | OGWVLJPOOBXDBS-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 73.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | 761 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |