C28H31FN4O5SSi — CID 91321233
(5R)-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione (PubChem CID 91321233) has the molecular formula C28H31FN4O5SSi and a molecular weight of 582.73 g/mol. Its IUPAC name is (5R)-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91321233 |
| Molecular Formula | C28H31FN4O5SSi |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | (5R)-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(c4nc(-c5ccc(F)cc5)cs4)NC(=O)N(COCC[Si](C)(C)C)C3=O)c(O)c2c1 |
| InChI | InChI=1S/C28H31FN4O5SSi/c1-37-21-10-7-19-14-32(24(34)22(19)13-21)16-28(25-30-23(15-39-25)18-5-8-20(29)9-6-18)26(35)33(27(36)31-28)17-38-11-12-40(2,3)4/h5-10,13-15,34H,11-12,16-17H2,1-4H3,(H,31,36)/t28-/m0/s1 |
| InChIKey | HVIYEKCFXHCNCJ-NDEPHWFRSA-N |
| XLogP | 5.38 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|