About benzene;N-ethyl-3-oxobutanamide
benzene;N-ethyl-3-oxobutanamide (PubChem CID 91322470) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is benzene;N-ethyl-3-oxobutanamide.
Molecular Properties
| Compound Name | benzene;N-ethyl-3-oxobutanamide |
| PubChem CID | 91322470 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | benzene;N-ethyl-3-oxobutanamide |
| SMILES | CCNC(=O)CC(C)=O.c1ccccc1 |
| InChI | InChI=1S/C6H11NO2.C6H6/c1-3-7-6(9)4-5(2)8;1-2-4-6-5-3-1/h3-4H2,1-2H3,(H,7,9);1-6H |
| InChIKey | IQIUBGATLFBFPL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze benzene;N-ethyl-3-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-ethyl-3-oxobutanamide?
The IUPAC name of benzene;N-ethyl-3-oxobutanamide (CID 91322470) is benzene;N-ethyl-3-oxobutanamide.
What is the SMILES notation for benzene;N-ethyl-3-oxobutanamide?
The canonical SMILES for benzene;N-ethyl-3-oxobutanamide is CCNC(=O)CC(C)=O.c1ccccc1.
What is the InChIKey of benzene;N-ethyl-3-oxobutanamide?
The InChIKey is IQIUBGATLFBFPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C6H6/c1-3-7-6(9)4-5(2)8;1-2-4-6-5-3-1/h3-4H2,1-2H3,(H,7,9);1-6H.
What are the key properties of benzene;N-ethyl-3-oxobutanamide?
benzene;N-ethyl-3-oxobutanamide has a molecular weight of 207.27 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-ethyl-3-oxobutanamide is sourced from PubChem (CID 91322470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).