C13H16INOSe — CID 101244501
N-[(Z)-2-iodo-3-phenylselanylprop-2-enyl]butanamide (PubChem CID 101244501) has the molecular formula C13H16INOSe and a molecular weight of 408.14 g/mol. Its IUPAC name is N-[(Z)-2-iodo-3-phenylselanylprop-2-enyl]butanamide.
| Compound Name | N-[(Z)-2-iodo-3-phenylselanylprop-2-enyl]butanamide |
|---|---|
| PubChem CID | 101244501 |
| Molecular Formula | C13H16INOSe |
| Molecular Weight | 408.14 g/mol |
| Exact Mass | 408.94 |
| IUPAC Name | N-[(Z)-2-iodo-3-phenylselanylprop-2-enyl]butanamide |
| SMILES | CCCC(=O)NC/C(I)=C/[Se]c1ccccc1 |
| InChI | InChI=1S/C13H16INOSe/c1-2-6-13(16)15-9-11(14)10-17-12-7-4-3-5-8-12/h3-5,7-8,10H,2,6,9H2,1H3,(H,15,16)/b11-10- |
| InChIKey | CNDQAEHLJCYAMJ-KHPPLWFESA-N |
| XLogP | 2.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.14 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|