About Se-phenyl N-heptylcarbamoselenoate
Se-phenyl N-heptylcarbamoselenoate (PubChem CID 11130281) has the molecular formula C14H21NOSe
and a molecular weight of 298.29 g/mol. Its IUPAC name is Se-phenyl N-heptylcarbamoselenoate.
Molecular Properties
| Compound Name | Se-phenyl N-heptylcarbamoselenoate |
| PubChem CID | 11130281 |
| Molecular Formula | C14H21NOSe |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | Se-phenyl N-heptylcarbamoselenoate |
| SMILES | CCCCCCCNC(=O)[Se]c1ccccc1 |
| InChI | InChI=1S/C14H21NOSe/c1-2-3-4-5-9-12-15-14(16)17-13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3,(H,15,16) |
| InChIKey | JWXXIIQBLVBQSI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Se-phenyl N-heptylcarbamoselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Se-phenyl N-heptylcarbamoselenoate?
The IUPAC name of Se-phenyl N-heptylcarbamoselenoate (CID 11130281) is Se-phenyl N-heptylcarbamoselenoate.
What is the SMILES notation for Se-phenyl N-heptylcarbamoselenoate?
The canonical SMILES for Se-phenyl N-heptylcarbamoselenoate is CCCCCCCNC(=O)[Se]c1ccccc1.
What is the InChIKey of Se-phenyl N-heptylcarbamoselenoate?
The InChIKey is JWXXIIQBLVBQSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NOSe/c1-2-3-4-5-9-12-15-14(16)17-13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3,(H,15,16).
What are the key properties of Se-phenyl N-heptylcarbamoselenoate?
Se-phenyl N-heptylcarbamoselenoate has a molecular weight of 298.29 g/mol, XLogP of 2.70, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Se-phenyl N-heptylcarbamoselenoate is sourced from PubChem (CID 11130281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).