C12H13IN2O7 — CID 91323802
3-[1-[(2S,5S)-3-hydroxy-5-(hydroxymethyl)-4-iodooxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-2-oxopropanal (PubChem CID 91323802) has the molecular formula C12H13IN2O7 and a molecular weight of 424.15 g/mol. Its IUPAC name is 3-[1-[(2S,5S)-3-hydroxy-5-(hydroxymethyl)-4-iodooxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-2-oxopropanal.
| Compound Name | 3-[1-[(2S,5S)-3-hydroxy-5-(hydroxymethyl)-4-iodooxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-2-oxopropanal |
|---|---|
| PubChem CID | 91323802 |
| Molecular Formula | C12H13IN2O7 |
| Molecular Weight | 424.15 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | 3-[1-[(2S,5S)-3-hydroxy-5-(hydroxymethyl)-4-iodooxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-2-oxopropanal |
| SMILES | O=CC(=O)Cc1cn([C@H]2O[C@@H](CO)C(I)C2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H13IN2O7/c13-8-7(4-17)22-11(9(8)19)15-2-5(1-6(18)3-16)10(20)14-12(15)21/h2-3,7-9,11,17,19H,1,4H2,(H,14,20,21)/t7-,8?,9?,11-/m0/s1 |
| InChIKey | GUCHRBURCNEXRJ-XVLZHWOZSA-N |
| XLogP | -2.10 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.15 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|