C25H32F3N7O4 — CID 91323934
2-[(3S)-1-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidin-3-yl]acetamide (PubChem CID 91323934) has the molecular formula C25H32F3N7O4 and a molecular weight of 551.57 g/mol. Its IUPAC name is 2-[(3S)-1-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidin-3-yl]acetamide.
| Compound Name | 2-[(3S)-1-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 91323934 |
| Molecular Formula | C25H32F3N7O4 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 2-[(3S)-1-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidin-3-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1CCN(C2CCC(CNc3nc(NCc4ccccc4OC(F)(F)F)ncc3[N+](=O)[O-])CC2)C1 |
| InChI | InChI=1S/C25H32F3N7O4/c26-25(27,28)39-21-4-2-1-3-18(21)13-31-24-32-14-20(35(37)38)23(33-24)30-12-16-5-7-19(8-6-16)34-10-9-17(15-34)11-22(29)36/h1-4,14,16-17,19H,5-13,15H2,(H2,29,36)(H2,30,31,32,33)/t16?,17-,19?/m0/s1 |
| InChIKey | RCNQGRSUNNCYLZ-HFCFLWKCSA-N |
| XLogP | 4.06 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|