C20H26BrN5O2Si — CID 91324453
N-[2-amino-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxamide (PubChem CID 91324453) has the molecular formula C20H26BrN5O2Si and a molecular weight of 476.45 g/mol. Its IUPAC name is N-[2-amino-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxamide.
| Compound Name | N-[2-amino-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91324453 |
| Molecular Formula | C20H26BrN5O2Si |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | N-[2-amino-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(NC(=O)c2[nH]nc3ncc(Br)cc23)c1N |
| InChI | InChI=1S/C20H26BrN5O2Si/c1-20(2,3)29(4,5)28-11-12-7-6-8-15(16(12)22)24-19(27)17-14-9-13(21)10-23-18(14)26-25-17/h6-10H,11,22H2,1-5H3,(H,24,27)(H,23,25,26) |
| InChIKey | HFIFKFWXZJQJGJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|