C27H29N5O5 — CID 91327314
2-amino-N-[2-(methoxymethyl)-4-[(2-piperidin-1-ylphenyl)carbamoyl]phenyl]-3-nitrobenzamide (PubChem CID 91327314) has the molecular formula C27H29N5O5 and a molecular weight of 503.56 g/mol. Its IUPAC name is 2-amino-N-[2-(methoxymethyl)-4-[(2-piperidin-1-ylphenyl)carbamoyl]phenyl]-3-nitrobenzamide.
| Compound Name | 2-amino-N-[2-(methoxymethyl)-4-[(2-piperidin-1-ylphenyl)carbamoyl]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 91327314 |
| Molecular Formula | C27H29N5O5 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-amino-N-[2-(methoxymethyl)-4-[(2-piperidin-1-ylphenyl)carbamoyl]phenyl]-3-nitrobenzamide |
| SMILES | COCc1cc(C(=O)Nc2ccccc2N2CCCCC2)ccc1NC(=O)c1cccc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C27H29N5O5/c1-37-17-19-16-18(26(33)30-22-9-3-4-10-23(22)31-14-5-2-6-15-31)12-13-21(19)29-27(34)20-8-7-11-24(25(20)28)32(35)36/h3-4,7-13,16H,2,5-6,14-15,17,28H2,1H3,(H,29,34)(H,30,33) |
| InChIKey | CJMYKLPEAPIYKD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|