C54H46Si3 — CID 91328172
10,10-dimethyl-14,21-di(spiro[benzo[b][1]benzosilole-5,1'-silolane]-2-yl)-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene (PubChem CID 91328172) has the molecular formula C54H46Si3 and a molecular weight of 779.22 g/mol. Its IUPAC name is 10,10-dimethyl-14,21-di(spiro[benzo[b][1]benzosilole-5,1'-silolane]-2-yl)-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene.
| Compound Name | 10,10-dimethyl-14,21-di(spiro[benzo[b][1]benzosilole-5,1'-silolane]-2-yl)-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 91328172 |
| Molecular Formula | C54H46Si3 |
| Molecular Weight | 779.22 g/mol |
| Exact Mass | 778.29 |
| IUPAC Name | 10,10-dimethyl-14,21-di(spiro[benzo[b][1]benzosilole-5,1'-silolane]-2-yl)-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene |
| SMILES | C[Si]1(C)c2ccccc2-c2cc3c(-c4ccc5c(c4)-c4ccccc4[Si]54CCCC4)c4ccccc4c(-c4ccc5c(c4)-c4ccccc4[Si]54CCCC4)c3cc21 |
| InChI | InChI=1S/C54H46Si3/c1-55(2)47-20-8-5-15-37(47)44-33-45-46(34-52(44)55)54(36-24-26-51-43(32-36)39-17-7-10-22-49(39)57(51)29-13-14-30-57)41-19-4-3-18-40(41)53(45)35-23-25-50-42(31-35)38-16-6-9-21-48(38)56(50)27-11-12-28-56/h3-10,15-26,31-34H,11-14,27-30H2,1-2H3 |
| InChIKey | CWYSEABOZZRZOB-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.22 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|