About (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene
(3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene (PubChem CID 91328187) has the molecular formula C23H32N2O2
and a molecular weight of 368.52 g/mol. Its IUPAC name is (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene.
Molecular Properties
| Compound Name | (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene |
| PubChem CID | 91328187 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene |
| SMILES | CC.Cc1ccccc1[N+](=O)[O-].c1ccc(C[C@H]2CN3CCC2CC3)cc1 |
| InChI | InChI=1S/C14H19N.C7H7NO2.C2H6/c1-2-4-12(5-3-1)10-14-11-15-8-6-13(14)7-9-15;1-6-4-2-3-5-7(6)8(9)10;1-2/h1-5,13-14H,6-11H2;2-5H,1H3;1-2H3/t14-;;/m0../s1 |
| InChIKey | BNFFAINCAJUTFH-UTLKBRERSA-N |
| XLogP | 5.50 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene?
The IUPAC name of (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene (CID 91328187) is (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene.
What is the SMILES notation for (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene?
The canonical SMILES for (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene is CC.Cc1ccccc1[N+](=O)[O-].c1ccc(C[C@H]2CN3CCC2CC3)cc1.
What is the InChIKey of (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene?
The InChIKey is BNFFAINCAJUTFH-UTLKBRERSA-N. The full InChI is InChI=1S/C14H19N.C7H7NO2.C2H6/c1-2-4-12(5-3-1)10-14-11-15-8-6-13(14)7-9-15;1-6-4-2-3-5-7(6)8(9)10;1-2/h1-5,13-14H,6-11H2;2-5H,1H3;1-2H3/t14-;;/m0../s1.
What are the key properties of (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene?
(3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene has a molecular weight of 368.52 g/mol, XLogP of 5.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;1-methyl-2-nitrobenzene is sourced from PubChem (CID 91328187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).