C14H26N4O4S2 — CID 91328752
N-[(2R)-1-amino-3-[[3-amino-2-(butanoylamino)-3-oxopropyl]disulfanyl]-1-oxopropan-2-yl]butanamide (PubChem CID 91328752) has the molecular formula C14H26N4O4S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[(2R)-1-amino-3-[[3-amino-2-(butanoylamino)-3-oxopropyl]disulfanyl]-1-oxopropan-2-yl]butanamide.
| Compound Name | N-[(2R)-1-amino-3-[[3-amino-2-(butanoylamino)-3-oxopropyl]disulfanyl]-1-oxopropan-2-yl]butanamide |
|---|---|
| PubChem CID | 91328752 |
| Molecular Formula | C14H26N4O4S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[(2R)-1-amino-3-[[3-amino-2-(butanoylamino)-3-oxopropyl]disulfanyl]-1-oxopropan-2-yl]butanamide |
| SMILES | CCCC(=O)NC(CSSC[C@H](NC(=O)CCC)C(N)=O)C(N)=O |
| InChI | InChI=1S/C14H26N4O4S2/c1-3-5-11(19)17-9(13(15)21)7-23-24-8-10(14(16)22)18-12(20)6-4-2/h9-10H,3-8H2,1-2H3,(H2,15,21)(H2,16,22)(H,17,19)(H,18,20)/t9-,10?/m0/s1 |
| InChIKey | XOXQJQGVKYBDDQ-RGURZIINSA-N |
| XLogP | -0.09 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|