C9H16N2O — CID 91329811
4-(2,4-diiminocyclopentyl)butan-2-ol (PubChem CID 91329811) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-(2,4-diiminocyclopentyl)butan-2-ol.
| Compound Name | 4-(2,4-diiminocyclopentyl)butan-2-ol |
|---|---|
| PubChem CID | 91329811 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 4-(2,4-diiminocyclopentyl)butan-2-ol |
| SMILES | [H]/N=C1\C/C(=N\[H])C(CCC(C)O)C1 |
| InChI | InChI=1S/C9H16N2O/c1-6(12)2-3-7-4-8(10)5-9(7)11/h6-7,10-12H,2-5H2,1H3/b10-8-,11-9+ |
| InChIKey | XFWGVJCQYQJRLZ-PNQPDEHRSA-N |
| XLogP | 1.60 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|