C8H12F3NO — CID 162591745
cis-(1R,2R)-4,4-difluoro-2-(2-fluoropropanimidoyl)cyclopentan-1-ol (PubChem CID 162591745) has the molecular formula C8H12F3NO and a molecular weight of 195.18 g/mol. Its IUPAC name is cis-(1R,2R)-4,4-difluoro-2-(2-fluoropropanimidoyl)cyclopentan-1-ol.
| Compound Name | cis-(1R,2R)-4,4-difluoro-2-(2-fluoropropanimidoyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 162591745 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | cis-(1R,2R)-4,4-difluoro-2-(2-fluoropropanimidoyl)cyclopentan-1-ol |
| SMILES | [H]/N=C(\C(C)F)[C@H]1CC(F)(F)C[C@H]1O |
| InChI | InChI=1S/C8H12F3NO/c1-4(9)7(12)5-2-8(10,11)3-6(5)13/h4-6,12-13H,2-3H2,1H3/b12-7+/t4?,5-,6+/m0/s1 |
| InChIKey | DFMFVIIKFBBSSV-ZCBFHKFMSA-N |
| XLogP | 1.77 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|