About 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol
2-ethanimidoyl-4,4-difluorocyclopentan-1-ol (PubChem CID 123874890) has the molecular formula C7H11F2NO
and a molecular weight of 163.17 g/mol. Its IUPAC name is 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol.
Molecular Properties
| Compound Name | 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol |
| PubChem CID | 123874890 |
| Molecular Formula | C7H11F2NO |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol |
| SMILES | [H]/N=C(\C)C1CC(F)(F)CC1O |
| InChI | InChI=1S/C7H11F2NO/c1-4(10)5-2-7(8,9)3-6(5)11/h5-6,10-11H,2-3H2,1H3/b10-4+ |
| InChIKey | BPWQQAOAJYIMFM-ONNFQVAWSA-N |
| XLogP | 1.43 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol?
The IUPAC name of 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol (CID 123874890) is 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol.
What is the SMILES notation for 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol?
The canonical SMILES for 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol is [H]/N=C(\C)C1CC(F)(F)CC1O.
What is the InChIKey of 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol?
The InChIKey is BPWQQAOAJYIMFM-ONNFQVAWSA-N. The full InChI is InChI=1S/C7H11F2NO/c1-4(10)5-2-7(8,9)3-6(5)11/h5-6,10-11H,2-3H2,1H3/b10-4+.
What are the key properties of 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol?
2-ethanimidoyl-4,4-difluorocyclopentan-1-ol has a molecular weight of 163.17 g/mol, XLogP of 1.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethanimidoyl-4,4-difluorocyclopentan-1-ol is sourced from PubChem (CID 123874890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).