C11H21NO — CID 163509549
cis-(1R,2R)-2-(2-ethylbutanimidoyl)cyclopentan-1-ol (PubChem CID 163509549) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is cis-(1R,2R)-2-(2-ethylbutanimidoyl)cyclopentan-1-ol.
| Compound Name | cis-(1R,2R)-2-(2-ethylbutanimidoyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 163509549 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | cis-(1R,2R)-2-(2-ethylbutanimidoyl)cyclopentan-1-ol |
| SMILES | [H]/N=C(\C(CC)CC)[C@H]1CCC[C@H]1O |
| InChI | InChI=1S/C11H21NO/c1-3-8(4-2)11(12)9-6-5-7-10(9)13/h8-10,12-13H,3-7H2,1-2H3/b12-11+/t9-,10+/m0/s1 |
| InChIKey | DBNOTWFCVDJTBP-XXQWGACESA-N |
| XLogP | 2.60 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|