About benzo[lmn]phenanthridine
benzo[lmn]phenanthridine (PubChem CID 9133) has the molecular formula C15H9N
and a molecular weight of 203.24 g/mol. Its IUPAC name is benzo[lmn]phenanthridine.
Molecular Properties
| Compound Name | benzo[lmn]phenanthridine |
| PubChem CID | 9133 |
| Molecular Formula | C15H9N |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | benzo[lmn]phenanthridine |
| SMILES | c1cc2ccc3cccc4ncc(c1)c2c34 |
| InChI | InChI=1S/C15H9N/c1-3-10-7-8-11-4-2-6-13-15(11)14(10)12(5-1)9-16-13/h1-9H |
| InChIKey | YEELFSTYCPPLQY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[lmn]phenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[lmn]phenanthridine?
The IUPAC name of benzo[lmn]phenanthridine (CID 9133) is benzo[lmn]phenanthridine.
What is the SMILES notation for benzo[lmn]phenanthridine?
The canonical SMILES for benzo[lmn]phenanthridine is c1cc2ccc3cccc4ncc(c1)c2c34.
What is the InChIKey of benzo[lmn]phenanthridine?
The InChIKey is YEELFSTYCPPLQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N/c1-3-10-7-8-11-4-2-6-13-15(11)14(10)12(5-1)9-16-13/h1-9H.
What are the key properties of benzo[lmn]phenanthridine?
benzo[lmn]phenanthridine has a molecular weight of 203.24 g/mol, XLogP of 3.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[lmn]phenanthridine is sourced from PubChem (CID 9133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).