C17H22O10S — CID 91330149
[(1R,3S,4R,6S)-3-acetyloxy-2,4,6-trihydroxy-5-(4-methylphenyl)sulfonyloxycyclohexyl] acetate (PubChem CID 91330149) has the molecular formula C17H22O10S and a molecular weight of 418.42 g/mol. Its IUPAC name is [(1R,3S,4R,6S)-3-acetyloxy-2,4,6-trihydroxy-5-(4-methylphenyl)sulfonyloxycyclohexyl] acetate.
| Compound Name | [(1R,3S,4R,6S)-3-acetyloxy-2,4,6-trihydroxy-5-(4-methylphenyl)sulfonyloxycyclohexyl] acetate |
|---|---|
| PubChem CID | 91330149 |
| Molecular Formula | C17H22O10S |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | [(1R,3S,4R,6S)-3-acetyloxy-2,4,6-trihydroxy-5-(4-methylphenyl)sulfonyloxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1C(O)[C@H](OC(C)=O)[C@@H](O)C(OS(=O)(=O)c2ccc(C)cc2)[C@H]1O |
| InChI | InChI=1S/C17H22O10S/c1-8-4-6-11(7-5-8)28(23,24)27-17-13(21)15(25-9(2)18)12(20)16(14(17)22)26-10(3)19/h4-7,12-17,20-22H,1-3H3/t12?,13-,14+,15+,16-,17? |
| InChIKey | KLJGHVHJPXWSHN-WAJHAFIMSA-N |
| XLogP | -0.97 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|