C11H22N2O2 — CID 91330204
2,2-ditert-butylpropanediamide (PubChem CID 91330204) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2,2-ditert-butylpropanediamide.
| Compound Name | 2,2-ditert-butylpropanediamide |
|---|---|
| PubChem CID | 91330204 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2,2-ditert-butylpropanediamide |
| SMILES | CC(C)(C)C(C(N)=O)(C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-9(2,3)11(7(12)14,8(13)15)10(4,5)6/h1-6H3,(H2,12,14)(H2,13,15) |
| InChIKey | CNOQYZAFCIRLEN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|