C32H54N2O4 — CID 91330966
N,13-dihydroxy-10-(methoxyamino)-N,2,4a,6a,6b,9,9,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxamide (PubChem CID 91330966) has the molecular formula C32H54N2O4 and a molecular weight of 530.79 g/mol. Its IUPAC name is N,13-dihydroxy-10-(methoxyamino)-N,2,4a,6a,6b,9,9,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxamide.
| Compound Name | N,13-dihydroxy-10-(methoxyamino)-N,2,4a,6a,6b,9,9,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxamide |
|---|---|
| PubChem CID | 91330966 |
| Molecular Formula | C32H54N2O4 |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 530.41 |
| IUPAC Name | N,13-dihydroxy-10-(methoxyamino)-N,2,4a,6a,6b,9,9,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxamide |
| SMILES | CONC1CCC2(C)C(CCC3(C)C2C(O)C=C2C4CC(C)(C(=O)N(C)O)CCC4(C)CCC23C)C1(C)C |
| InChI | InChI=1S/C32H54N2O4/c1-27(2)23-10-13-32(7)25(30(23,5)12-11-24(27)33-38-9)22(35)18-20-21-19-29(4,26(36)34(8)37)15-14-28(21,3)16-17-31(20,32)6/h18,21-25,33,35,37H,10-17,19H2,1-9H3 |
| InChIKey | YTKSUNHQJAMNAN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|