C48H46Cl2N2O7 — CID 91333463
dimethyl 4-(2,6-dichlorophenyl)-2-(2-methoxy-2-oxoethyl)-6-[2-[2-[2-(tritylamino)ethoxymethyl]phenyl]ethyl]-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 91333463) has the molecular formula C48H46Cl2N2O7 and a molecular weight of 833.81 g/mol. Its IUPAC name is dimethyl 4-(2,6-dichlorophenyl)-2-(2-methoxy-2-oxoethyl)-6-[2-[2-[2-(tritylamino)ethoxymethyl]phenyl]ethyl]-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(2,6-dichlorophenyl)-2-(2-methoxy-2-oxoethyl)-6-[2-[2-[2-(tritylamino)ethoxymethyl]phenyl]ethyl]-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 91333463 |
| Molecular Formula | C48H46Cl2N2O7 |
| Molecular Weight | 833.81 g/mol |
| Exact Mass | 832.27 |
| IUPAC Name | dimethyl 4-(2,6-dichlorophenyl)-2-(2-methoxy-2-oxoethyl)-6-[2-[2-[2-(tritylamino)ethoxymethyl]phenyl]ethyl]-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)CC1=NC(CCc2ccccc2COCCNC(c2ccccc2)(c2ccccc2)c2ccccc2)=C(C(=O)OC)C(c2c(Cl)cccc2Cl)C1C(=O)OC |
| InChI | InChI=1S/C48H46Cl2N2O7/c1-56-41(53)30-40-44(47(55)58-3)45(42-37(49)24-15-25-38(42)50)43(46(54)57-2)39(52-40)27-26-32-16-13-14-17-33(32)31-59-29-28-51-48(34-18-7-4-8-19-34,35-20-9-5-10-21-35)36-22-11-6-12-23-36/h4-25,44-45,51H,26-31H2,1-3H3 |
| InChIKey | MDPFWNHZZBBPLK-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.81 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|