C26H21N5O6S — CID 91333623
1-(2-methylsulfonylphenyl)-8-[(2-nitrobenzoyl)amino]-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 91333623) has the molecular formula C26H21N5O6S and a molecular weight of 531.55 g/mol. Its IUPAC name is 1-(2-methylsulfonylphenyl)-8-[(2-nitrobenzoyl)amino]-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 1-(2-methylsulfonylphenyl)-8-[(2-nitrobenzoyl)amino]-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 91333623 |
| Molecular Formula | C26H21N5O6S |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 1-(2-methylsulfonylphenyl)-8-[(2-nitrobenzoyl)amino]-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccccc1-n1nc(C(N)=O)c2c1-c1cc(NC(=O)c3ccccc3[N+](=O)[O-])ccc1CC2 |
| InChI | InChI=1S/C26H21N5O6S/c1-38(36,37)22-9-5-4-8-21(22)30-24-18(23(29-30)25(27)32)13-11-15-10-12-16(14-19(15)24)28-26(33)17-6-2-3-7-20(17)31(34)35/h2-10,12,14H,11,13H2,1H3,(H2,27,32)(H,28,33) |
| InChIKey | JKETTWNOMBTMAV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 167.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|