C26H20N8O6S — CID 22291636
8-[(5-azido-2-nitrobenzoyl)amino]-1-(4-methylsulfonylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 22291636) has the molecular formula C26H20N8O6S and a molecular weight of 572.56 g/mol. Its IUPAC name is 8-[(5-azido-2-nitrobenzoyl)amino]-1-(4-methylsulfonylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-[(5-azido-2-nitrobenzoyl)amino]-1-(4-methylsulfonylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 22291636 |
| Molecular Formula | C26H20N8O6S |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 8-[(5-azido-2-nitrobenzoyl)amino]-1-(4-methylsulfonylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(-n2nc(C(N)=O)c3c2-c2cc(NC(=O)c4cc(N=[N+]=[N-])ccc4[N+](=O)[O-])ccc2CC3)cc1 |
| InChI | InChI=1S/C26H20N8O6S/c1-41(39,40)18-8-6-17(7-9-18)33-24-19(23(31-33)25(27)35)10-3-14-2-4-15(12-20(14)24)29-26(36)21-13-16(30-32-28)5-11-22(21)34(37)38/h2,4-9,11-13H,3,10H2,1H3,(H2,27,35)(H,29,36) |
| InChIKey | BJRXXEHKEMSWKA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 216.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|