C23H19N5O2S2 — CID 87999814
1-(4-aminosulfanylphenyl)-8-(thiophene-2-carbonylamino)-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 87999814) has the molecular formula C23H19N5O2S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 1-(4-aminosulfanylphenyl)-8-(thiophene-2-carbonylamino)-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 1-(4-aminosulfanylphenyl)-8-(thiophene-2-carbonylamino)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 87999814 |
| Molecular Formula | C23H19N5O2S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 1-(4-aminosulfanylphenyl)-8-(thiophene-2-carbonylamino)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | NSc1ccc(-n2nc(C(N)=O)c3c2-c2cc(NC(=O)c4cccs4)ccc2CC3)cc1 |
| InChI | InChI=1S/C23H19N5O2S2/c24-22(29)20-17-10-4-13-3-5-14(26-23(30)19-2-1-11-31-19)12-18(13)21(17)28(27-20)15-6-8-16(32-25)9-7-15/h1-3,5-9,11-12H,4,10,25H2,(H2,24,29)(H,26,30) |
| InChIKey | ZUFINEZFVOEOFU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|