C19H17N5O2S — CID 142828755
1-(4-aminosulfanylphenyl)-8-formamido-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 142828755) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is 1-(4-aminosulfanylphenyl)-8-formamido-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 1-(4-aminosulfanylphenyl)-8-formamido-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 142828755 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-(4-aminosulfanylphenyl)-8-formamido-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | NSc1ccc(-n2nc(C(N)=O)c3c2-c2cc(NC=O)ccc2CC3)cc1 |
| InChI | InChI=1S/C19H17N5O2S/c20-19(26)17-15-8-2-11-1-3-12(22-10-25)9-16(11)18(15)24(23-17)13-4-6-14(27-21)7-5-13/h1,3-7,9-10H,2,8,21H2,(H2,20,26)(H,22,25) |
| InChIKey | UXZWMJNKZSTEDD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|