C18H17N5O2S — CID 142828934
8-amino-1-(4-sulfinamoylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 142828934) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is 8-amino-1-(4-sulfinamoylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-amino-1-(4-sulfinamoylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 142828934 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 8-amino-1-(4-sulfinamoylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccc(S(N)=O)cc2)c2c1CCc1ccc(N)cc1-2 |
| InChI | InChI=1S/C18H17N5O2S/c19-11-3-1-10-2-8-14-16(18(20)24)22-23(17(14)15(10)9-11)12-4-6-13(7-5-12)26(21)25/h1,3-7,9H,2,8,19,21H2,(H2,20,24) |
| InChIKey | VDMFFYVINDVLFV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|