C25H19ClFN5O2 — CID 10205787
8-[(4-amino-2-chlorobenzoyl)amino]-1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 10205787) has the molecular formula C25H19ClFN5O2 and a molecular weight of 475.91 g/mol. Its IUPAC name is 8-[(4-amino-2-chlorobenzoyl)amino]-1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-[(4-amino-2-chlorobenzoyl)amino]-1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 10205787 |
| Molecular Formula | C25H19ClFN5O2 |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 8-[(4-amino-2-chlorobenzoyl)amino]-1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccc(F)cc2)c2c1CCc1ccc(NC(=O)c3ccc(N)cc3Cl)cc1-2 |
| InChI | InChI=1S/C25H19ClFN5O2/c26-21-11-15(28)5-10-18(21)25(34)30-16-6-1-13-2-9-19-22(24(29)33)31-32(23(19)20(13)12-16)17-7-3-14(27)4-8-17/h1,3-8,10-12H,2,9,28H2,(H2,29,33)(H,30,34) |
| InChIKey | XYGXLADEYPHLKB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|