C29H30N4O2 — CID 142223066
8-[[(2E,4Z)-2,7-dimethylocta-2,4,6-trienoyl]amino]-1-(4-methylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 142223066) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 8-[[(2E,4Z)-2,7-dimethylocta-2,4,6-trienoyl]amino]-1-(4-methylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-[[(2E,4Z)-2,7-dimethylocta-2,4,6-trienoyl]amino]-1-(4-methylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 142223066 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 8-[[(2E,4Z)-2,7-dimethylocta-2,4,6-trienoyl]amino]-1-(4-methylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | CC(C)=C/C=C\C=C(/C)C(=O)Nc1ccc2c(c1)-c1c(c(C(N)=O)nn1-c1ccc(C)cc1)CC2 |
| InChI | InChI=1S/C29H30N4O2/c1-18(2)7-5-6-8-20(4)29(35)31-22-13-11-21-12-16-24-26(28(30)34)32-33(27(24)25(21)17-22)23-14-9-19(3)10-15-23/h5-11,13-15,17H,12,16H2,1-4H3,(H2,30,34)(H,31,35)/b6-5-,20-8+ |
| InChIKey | UJILFIIORMSJCF-JXEGDEGUSA-N |
| XLogP | 5.45 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|