C27H26ClN5O2 — CID 142828956
1-(4-ethenylphenyl)-8-(methylamino)-4,5-dihydrobenzo[g]indazole-3-carboxamide;(2Z)-2-formylpenta-2,4-dienimidoyl chloride (PubChem CID 142828956) has the molecular formula C27H26ClN5O2 and a molecular weight of 487.99 g/mol. Its IUPAC name is 1-(4-ethenylphenyl)-8-(methylamino)-4,5-dihydrobenzo[g]indazole-3-carboxamide;(2Z)-2-formylpenta-2,4-dienimidoyl chloride.
| Compound Name | 1-(4-ethenylphenyl)-8-(methylamino)-4,5-dihydrobenzo[g]indazole-3-carboxamide;(2Z)-2-formylpenta-2,4-dienimidoyl chloride |
|---|---|
| PubChem CID | 142828956 |
| Molecular Formula | C27H26ClN5O2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 1-(4-ethenylphenyl)-8-(methylamino)-4,5-dihydrobenzo[g]indazole-3-carboxamide;(2Z)-2-formylpenta-2,4-dienimidoyl chloride |
| SMILES | C=Cc1ccc(-n2nc(C(N)=O)c3c2-c2cc(NC)ccc2CC3)cc1.[H]/N=C(Cl)/C(C=O)=C\C=C |
| InChI | InChI=1S/C21H20N4O.C6H6ClNO/c1-3-13-4-9-16(10-5-13)25-20-17(19(24-25)21(22)26)11-7-14-6-8-15(23-2)12-18(14)20;1-2-3-5(4-9)6(7)8/h3-6,8-10,12,23H,1,7,11H2,2H3,(H2,22,26);2-4,8H,1H2/b;5-3-,8-6- |
| InChIKey | WCQUDADVBVRLFM-GLAFGRSUSA-N |
| XLogP | 4.94 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|